id
int64 0
71k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
|---|---|---|---|
70,300
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][C][Ring2][Ring1][C]",
"[N][C][C][C][N][Branch2][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][C][Ring2][Ring1][C]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1",
"NC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
70,301
|
{
"selfies": [
"[C][N][C]",
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][Branch1][C][F][C][=C][Ring1][Branch2][Cl]",
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][Branch1][=Branch1][N][Branch1][C][C][C][C][=C][Ring1][#Branch2][Cl]"
],
"smiles": [
"CNC",
"COC(=O)c1cc(F)c(F)cc1Cl",
"COC(=O)c1cc(F)c(N(C)C)cc1Cl"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
70,302
|
{
"selfies": [
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][=C][N][=C][Branch2][Ring1][Ring1][N][C][C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][S][Ring1][P]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][=C][N][=C][Branch1][=Branch1][N][C][C][C][N][S][Ring1][#Branch2]"
],
"smiles": [
"Cc1ccccc1C(=O)c1cnc(NCCCNC(=O)OC(C)(C)C)s1",
"Cc1ccccc1C(=O)c1cnc(NCCCN)s1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be C1COCCO1 .",
"role": "assistant"
}
] | |
70,303
|
{
"selfies": [
"[C][C][C][N][C][C][N][Ring1][=Branch1]",
"[C][C][=C][Branch1][C][Cl][N][=N][C][Branch1][C][Cl][=C][Ring1][Branch2][C]",
"[C][C][=C][Branch1][C][Cl][N][=N][C][Branch1][N][N][C][C][N][C][Branch1][C][C][C][Ring1][#Branch1][=C][Ring1][=C][C]"
],
"smiles": [
"CC1CNCCN1",
"Cc1c(Cl)nnc(Cl)c1C",
"Cc1c(Cl)nnc(N2CCNC(C)C2)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,304
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][=Branch1][C][=O][N][Branch1][#C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=Branch1][C][=O][C][Ring1][#C][Branch1][=N][C][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][Ring2][Ring1][O]",
"[O][=C][N][Branch1][#C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=Branch1][C][=O][C][Branch1][=N][C][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][N][C][C][N][Ring2][Ring1][#Branch2][Ring1][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN2C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)C2(Cc2ccc(Br)cc2)C1",
"O=C1N(c2cc(Cl)cc(Cl)c2)C(=O)C2(Cc3ccc(Br)cc3)CNCCN12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,305
|
{
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[O][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][C][Branch1][C][O][C][Ring1][=Branch1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#C]"
],
"smiles": [
"CS(=O)(=O)Cl",
"O=C(OCc1ccccc1)N1CCC(O)C1",
"CS(=O)(=O)OC1CCN(C(=O)OCc2ccccc2)C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "c1ccncc1 .",
"role": "assistant"
}
] | |
70,306
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][I]",
"[N][C][C][Branch1][C][O][C][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2]",
"[O][=C][Branch1][N][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][I][N][C][C][Branch1][C][O][C][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2]"
],
"smiles": [
"CCOC(=O)COc1ccccc1I",
"NCC(O)CN1CCc2ccccc2C1",
"O=C(COc1ccccc1I)NCC(O)CN1CCc2ccccc2C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,307
|
{
"selfies": [
"[C][C][=Branch1][C][=O][Cl]",
"[C][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][C][C][N][C][C][Ring1][Branch1][C][Ring1][=Branch1][C][=C][Ring1][N][C][=Branch1][C][=O][O][Ring2][Ring1][C]",
"[C][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring1][=N][C][=C][C][=C][Branch2][Ring1][C][C][C][C][Ring1][Ring1][C][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][Ring1][=Branch2][C][=C][Ring1][#C][C][=Branch1][C][=O][O][Ring2][Ring1][Branch1]"
],
"smiles": [
"CC(=O)Cl",
"CC(=O)NCC1CN(c2ccc(C34CNCC3C4)cc2)C(=O)O1",
"CC(=O)NCC1CN(c2ccc(C34CC3CN(C(C)=O)C4)cc2)C(=O)O1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl.O .",
"role": "assistant"
}
] | |
70,308
|
{
"selfies": [
"[C][C][Branch1][C][C][Si][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][O][C][=Branch1][C][=O][C][C][Branch1][C][O][C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]",
"[C][O][C][=Branch1][C][=O][C][C][Branch2][Ring1][=Branch1][O][Si][Branch1][=Branch1][C][Branch1][C][C][C][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C][C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)[Si](OS(=O)(=O)C(F)(F)F)(C(C)C)C(C)C",
"COC(=O)CC(O)C(NC(=O)OCc1ccccc1)C(C)C",
"COC(=O)CC(O[Si](C(C)C)(C(C)C)C(C)C)C(NC(=O)OCc1ccccc1)C(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
70,309
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring2][Ring2][C][N][C][=Branch1][C][=O][N][N][=C][N][=C][Ring1][Branch1][C][=C][C][Branch1][#Branch2][C][N][C][C][N][C][C][Ring1][=Branch1][=C][N][=C][Ring1][=N][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][N]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][O][C][=C][C][=C][Branch2][Ring2][#C][C][N][C][=Branch1][C][=O][N][N][=C][N][=C][Ring1][Branch1][C][=C][C][Branch2][Ring1][Ring2][C][N][C][C][N][Branch1][=Branch2][S][Branch1][C][C][=Branch1][C][=O][=O][C][C][Ring1][#Branch2][=C][N][=C][Ring1][P][Ring2][Ring1][=Branch2][C][=C][Ring2][Ring1][S]"
],
"smiles": [
"COc1ccc(Cn2c(=O)n3ncnc3c3cc(CN4CCNCC4)cnc32)cc1",
"CS(=O)(=O)Cl",
"COc1ccc(Cn2c(=O)n3ncnc3c3cc(CN4CCN(S(C)(=O)=O)CC4)cnc32)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
70,310
|
{
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][N][Branch1][S][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][C][Ring1][#C]",
"[C][C][=Branch1][C][=O][N][C][C][N][Branch1][N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][C][Ring1][=N]"
],
"smiles": [
"CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1",
"CC(=O)N1CCN(c2ccc(N)cc2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,311
|
{
"selfies": [
"[C][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][N]",
"[C][C][=C][C][=C][C][Branch1][C][N][=C][Ring1][#Branch1][N]"
],
"smiles": [
"Cc1cccc([N+](=O)[O-])c1N",
"Cc1cccc(N)c1N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
70,312
|
{
"selfies": [
"[Br][Br]",
"[C][C][N][C][=N][C][Branch1][C][C][=C][C][=C][C][=Branch1][C][=O][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][C][Ring1][=N][=N][Ring2][Ring1][C]",
"[C][C][N][C][=N][C][Branch1][C][C][=C][C][=C][Branch1][C][Br][C][=Branch1][C][=O][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][C][Ring1][=C][=N][Ring2][Ring1][Ring1]"
],
"smiles": [
"BrBr",
"CCNc1nc(C)c2ccc(=O)n(C3CCCCC3)c2n1",
"CCNc1nc(C)c2cc(Br)c(=O)n(C3CCCCC3)c2n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(=O)O.ClCCl .",
"role": "assistant"
}
] | |
70,313
|
{
"selfies": [
"[N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][O]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][Branch1][C][Cl][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O]",
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O]"
],
"smiles": [
"Nc1cc(Cl)ccc1C(=O)O",
"O=S(=O)(Cl)c1ccc(Cl)c(C(F)(F)F)c1",
"O=C(O)c1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1COCCO1.O .",
"role": "assistant"
}
] | |
70,314
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][C][=C][Branch2][Ring1][=C][N][C][=Branch1][C][=O][C][=C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][S][Ring1][=Branch1][C][Branch1][C][Cl][=C][Ring2][Ring1][#Branch2]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][Branch2][Ring1][=C][N][C][=Branch1][C][=O][C][=C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][S][Ring1][=Branch1][C][Branch1][C][Cl][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"COC(=O)Cc1ccc(NC(=O)c2cn(Cc3ccccc3)c3ccccc23)c(Cl)c1",
"O=C(O)Cc1ccc(NC(=O)c2cn(Cc3ccccc3)c3ccccc23)c(Cl)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,315
|
{
"selfies": [
"[C][C][=C][Branch1][C][Cl][C][=C][N+1][Branch1][C][O-1][=C][Ring1][Branch2][C]",
"[O][C][C][C][O][C][Branch1][Branch2][C][C][O][C][C][Ring1][=Branch1][O][C][Ring1][O]",
"[C][C][=C][Branch2][Ring1][Ring2][O][C][C][C][O][C][Branch1][Branch2][C][C][O][C][C][Ring1][=Branch1][O][C][Ring1][O][C][=C][N+1][Branch1][C][O-1][=C][Ring2][Ring1][Ring2][C]"
],
"smiles": [
"Cc1c(Cl)cc[n+]([O-])c1C",
"OCC1COC2(CCOCC2)OC1",
"Cc1c(OCC2COC3(CCOCC3)OC2)cc[n+]([O-])c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
70,316
|
{
"selfies": [
"[C][O][C][=C][C][=C][C][=Branch2][Ring1][=N][=C][Ring1][=Branch1][C][C][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][O][C][=Branch1][#C][=C][C][=N][NH1][C][=C][C][=C][C][=C][Ring1][=Branch2][Ring1][=Branch1][C][Ring2][Ring1][#C][=O]",
"[C][O][C][=C][C][=C][C][=Branch1][=C][=C][Ring1][=Branch1][C][C][C][C][C][N][C][C][Ring1][=Branch1][O][C][=Branch1][#C][=C][C][=N][NH1][C][=C][C][=C][C][=C][Ring1][=Branch2][Ring1][=Branch1][C][Ring2][Ring1][Branch2][=O]"
],
"smiles": [
"COc1ccc2c(c1CCC1CCN(C(=O)OC(C)(C)C)CC1)OC(=Cc1n[nH]c3ccccc13)C2=O",
"COc1ccc2c(c1CCC1CCNCC1)OC(=Cc1n[nH]c3ccccc13)C2=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1COCCO1.ClCCl .",
"role": "assistant"
}
] | |
70,317
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][N][=C][S][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[C][C][Branch1][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][N][=C][S][C][Ring1][Branch1][=C][Ring1][=Branch2]"
],
"smiles": [
"CCOC(=O)C(C)(C)S(=O)(=O)c1ccc2ncsc2c1",
"CC(C)(C(=O)O)S(=O)(=O)c1ccc2ncsc2c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1COCCO1.O .",
"role": "assistant"
}
] | |
70,318
|
{
"selfies": [
"[C][O][C][C][=C][C][=C][N][=C][Branch1][=C][N][C][=C][N][=C][Branch1][Ring1][C][#N][C][=N][Ring1][Branch2][C][=C][Ring1][#C][N][C][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N]",
"[C][O][C][C][=C][C][=C][N][=C][Branch1][=C][N][C][=C][N][=C][Branch1][Ring1][C][#N][C][=N][Ring1][Branch2][C][=C][Ring1][#C][N][C][C][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"COCC=Cc1cnc(Nc2cnc(C#N)cn2)cc1NCC1CCN(C(=O)OC(C)(C)C)CC1",
"COCC=Cc1cnc(Nc2cnc(C#N)cn2)cc1NCC1CCNCC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl .",
"role": "assistant"
}
] | |
70,319
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Branch1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch2][Ring1][Ring2][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][C][Ring1][O][=N][C][C][Ring2][Ring1][C][C][C][Ring2][Ring2][C]",
"[O][=S][=Branch1][C][=O][Branch2][Ring2][N][N][C][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch2][Ring1][Ring2][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][C][Ring1][O][=N][C][C][Ring2][Ring1][C][N][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"CCOC(=O)N1CCN(S(=O)(=O)NCCOc2ccc3c(c2)C(C2(c4ccc(Cl)cc4)CCC2)=NCC3)CC1",
"O=S(=O)(NCCOc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)=NCC2)N1CCNCC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,320
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][N][N][=C][N][=C][Branch1][C][N][C][Ring1][#Branch1][=C][Ring1][#Branch2][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]",
"[C][C][O][C][=Branch1][C][=O][C][=C][N][N][=C][N][=C][Branch1][C][N][C][Ring1][#Branch1][=C][Ring1][#Branch2][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CCOC(=O)c1cn2ncnc(N)c2c1-c1ccc([N+](=O)[O-])cc1",
"CCOC(=O)c1cn2ncnc(N)c2c1-c1ccc(N)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1CCOC1.CCO .",
"role": "assistant"
}
] | |
70,321
|
{
"selfies": [
"[N][C][C][C][C][C][C][C][=C][Ring1][Branch1][C][C][=C][C][Ring1][=Branch1]",
"[O][=C][Branch1][=C][O][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[O][=C][Branch2][Ring1][C][N][C][C][C][C][C][C][C][=C][Ring1][Branch1][C][C][=C][C][Ring1][=Branch1][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"NCCCC1CCC2=C1CC=CC2",
"O=C(OC(=O)C(F)(F)F)C(F)(F)F",
"O=C(NCCCC1CCC2=C1CC=CC2)C(F)(F)F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCOCC .",
"role": "assistant"
}
] | |
70,322
|
{
"selfies": [
"[C][C][N][C][C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][C][Ring1][N]",
"[O][=C][N][C][C][C][C][C][Ring1][#Branch1][N][C][=N][C][Branch1][C][Cl][=N][C][=C][Ring1][#Branch1][Cl]",
"[C][C][N][C][C][C][=C][C][=C][Branch2][Ring1][#Branch2][N][C][=N][C][=C][Branch1][C][Cl][C][Branch1][N][N][C][C][C][C][C][N][C][Ring1][#Branch1][=O][=N][Ring1][S][C][=C][Ring2][Ring1][#Branch1][C][C][Ring2][Ring1][N]"
],
"smiles": [
"CCN1CCc2ccc(N)cc2CC1",
"O=C1NCCCCC1Nc1nc(Cl)ncc1Cl",
"CCN1CCc2ccc(Nc3ncc(Cl)c(NC4CCCCNC4=O)n3)cc2CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CC(C)O.O .",
"role": "assistant"
}
] | |
70,323
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch1][Ring2][C][C][N][C][=C][Ring1][=Branch2][O][C]",
"[C][C][=C][C][=C][Branch1][Branch2][N][C][C][=Branch1][C][=O][O][C][=C][Ring1][O]",
"[C][O][C][=C][C][=C][Branch2][Ring1][Branch1][C][C][N][C][=Branch1][C][=O][C][N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Ring2][O][C]"
],
"smiles": [
"COc1ccc(CCN)cc1OC",
"Cc1ccc(NCC(=O)O)cc1",
"COc1ccc(CCNC(=O)CNc2ccc(C)cc2)cc1OC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CCOC(C)=O .",
"role": "assistant"
}
] | |
70,324
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][#Branch1][C][=C][C][=C][Branch1][=N][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][S][C][=C][Ring2][Ring1][=Branch1]",
"[C][O][C][=C][C][=C][Branch1][=C][C][=C][C][=C][Branch1][Ring2][C][C][O][C][=C][Ring1][=Branch2][C][=C][Ring1][#C]"
],
"smiles": [
"COc1ccc(-c2ccc(CCOCc3ccccc3)cc2)cc1",
"COc1ccc(-c2ccc(CCO)cc2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
70,325
|
{
"selfies": [
"[F][C][=C][C][Branch2][Ring1][=Branch1][C][=N][C][Branch1][O][N][C][C][C][C][O][C][C][Ring1][=Branch1][=C][N][=C][Ring1][=C][Cl][=C][Branch1][C][Cl][C][=N][Ring2][Ring1][=Branch1]",
"[N][C][C][C][C][Branch1][C][N][C][C][Ring1][#Branch1]",
"[N][C][C][C][C][Branch2][Ring2][=Branch1][N][C][=C][C][Branch2][Ring1][=Branch1][C][=N][C][Branch1][O][N][C][C][C][C][O][C][C][Ring1][=Branch1][=C][N][=C][Ring1][=C][Cl][=C][Branch1][C][Cl][C][=N][Ring2][Ring1][=Branch1][C][C][Ring2][Ring1][=N]"
],
"smiles": [
"Fc1cc(-c2nc(NCC3CCOCC3)cnc2Cl)c(Cl)cn1",
"NC1CCC(N)CC1",
"NC1CCC(Nc2cc(-c3nc(NCC4CCOCC4)cnc3Cl)c(Cl)cn2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CS(C)=O .",
"role": "assistant"
}
] | |
70,326
|
{
"selfies": [
"[C][C][C][N][N][=C][C][C][=Branch1][C][=O][NH1][C][Branch1][N][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][=N][C][=Ring1][S][Ring2][Ring1][Ring1]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][C][C][N][N][=C][C][C][=Branch1][C][=O][NH1][C][Branch1][#C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][O][C][C][=N][C][=Ring1][P][Ring2][Ring1][Ring2]"
],
"smiles": [
"CCCn1ncc2c(=O)[nH]c(-c3ccccc3OCC)nc21",
"O=C1CCC(=O)N1Br",
"CCCn1ncc2c(=O)[nH]c(-c3cc(Br)ccc3OCC)nc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,327
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]",
"[O][C][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"O=C(O)c1cccc(Cl)c1C(F)(F)F",
"OCc1cccc(Cl)c1C(F)(F)F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1CCOC1 .",
"role": "assistant"
}
] | |
70,328
|
{
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][S][Branch1][C][C][=Branch1][C][=O][=O]"
],
"smiles": [
"CS(=O)(=O)Cl",
"Cc1ccccc1N",
"Cc1ccccc1NS(C)(=O)=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,329
|
{
"selfies": [
"[C][C][Branch1][C][N][C][=N][C][=C][S][Ring1][Branch1]",
"[C][O][C][=C][C][=N][C][=C][C][Branch2][Ring1][#Branch1][O][C][=C][C][=C][Branch1][C][N][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][=Branch1][O][C]",
"[O][=C][Branch1][#Branch2][O][C][Branch1][C][Cl][Branch1][C][Cl][Cl][O][C][Branch1][C][Cl][Branch1][C][Cl][Cl]",
"[C][O][C][=C][C][=N][C][=C][C][Branch2][Ring2][=Branch2][O][C][=C][C][=C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][Branch1][C][C][C][=N][C][=C][S][Ring1][Branch1][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][Branch1][=C][Ring2][Ring1][N][C][=C][Ring2][Ring1][S][O][C]"
],
"smiles": [
"CC(N)c1nccs1",
"COc1cc2nccc(Oc3ccc(N)c(C(F)(F)F)c3)c2cc1OC",
"O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl",
"COc1cc2nccc(Oc3ccc(NC(=O)NC(C)c4nccs4)c(C(F)(F)F)c3)c2cc1OC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClC(Cl)Cl .",
"role": "assistant"
}
] | |
70,330
|
{
"selfies": [
"[C][C][Branch1][C][N][C][O][C][Ring1][Branch1]",
"[C][N][N][=C][Branch2][Ring1][Branch1][C][=C][N][=C][NH1][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][Branch2][=N][Ring1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][Ring2][Ring1][=Branch1]",
"[C][N][N][=C][Branch2][Ring1][=C][C][=C][N][=C][NH1][C][=C][Branch1][#C][C][=Branch1][C][=O][N][C][Branch1][C][C][C][O][C][Ring1][Branch1][C][Ring1][=N][=N][Ring1][P][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][Ring2][Ring1][O]"
],
"smiles": [
"CC1(N)COC1",
"Cn1nc(-c2cnc3[nH]cc(C(=O)O)c3n2)c2ccc(F)cc21",
"Cn1nc(-c2cnc3[nH]cc(C(=O)NC4(C)COC4)c3n2)c2ccc(F)cc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CN(C)C=O .",
"role": "assistant"
}
] | |
70,331
|
{
"selfies": [
"[C][C][C][=C][N][=C][Branch2][Branch1][=Branch2][N][Branch2][Ring2][C][C][C][C][=C][S][C][Branch2][Ring1][=Branch1][S][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=N][Ring1][S][C][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][N][N][=C][Ring2][Ring2][=Branch1]",
"[C][C][C][=C][N][=C][Branch2][Ring2][S][N][Branch2][Ring1][=Branch2][C][C][C][=C][S][C][Branch1][=C][S][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][O][=N][Ring1][N][C][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][N][N][=C][Ring2][Ring2][C]"
],
"smiles": [
"CCc1cnc(N(CCc2csc(SC(C)(C)C(=O)OC(C)(C)C)n2)Cc2ccc(N3CCOCC3)cc2)nc1",
"CCc1cnc(N(CCc2csc(SC(C)(C)C(=O)O)n2)Cc2ccc(N3CCOCC3)cc2)nc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,332
|
{
"selfies": [
"[C][N]",
"[O][C][C][C][=Branch2][Ring1][#Branch2][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][Branch1][O][C][C][Br][C][=C][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][N][C][C][O][C][=C][C][=C][Branch2][Ring1][#Branch2][C][=Branch1][#C][=C][Branch1][Ring2][C][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CN",
"OCCC(=C(c1ccccc1)c1ccc(OCCBr)cc1)c1ccccc1",
"CNCCOc1ccc(C(=C(CCO)c2ccccc2)c2ccccc2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCO .",
"role": "assistant"
}
] | |
70,333
|
{
"selfies": [
"[C][C][O][Ring1][Ring1]",
"[C][C][C][C][C][C][C][C][N][C][C]",
"[C][C][C][C][C][C][C][C][N][Branch1][Ring1][C][C][C][C][O]"
],
"smiles": [
"C1CO1",
"CCCCCCCCNCC",
"CCCCCCCCN(CC)CCO"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCO .",
"role": "assistant"
}
] | |
70,334
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][N][Branch2][Ring1][Branch1][C][C][C][N][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][N][Branch1][P][C][C][C][N][C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCCCN(CCCNCc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C",
"CC(C)(C)OC(=O)NCCCCN(CCCNCc1ccc(N)cc1)C(=O)OC(C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,335
|
{
"selfies": [
"[C][C][=C][Branch1][S][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][C][=C][Ring1][#C][N+1][=Branch1][C][=O][O-1]",
"[C][C][=C][Branch1][C][N][C][=C][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
],
"smiles": [
"Cc1c(C(=O)c2ccc(F)cc2)cccc1[N+](=O)[O-]",
"Cc1c(N)cccc1C(=O)c1ccc(F)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO.O .",
"role": "assistant"
}
] | |
70,336
|
{
"selfies": [
"[C][O][C][C][C][O][C][=C][C][=N][C][Branch1][S][C][S][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2][=C][Ring1][P][C]",
"[O][=C][Branch1][Ring1][O][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[C][O][C][C][C][O][C][=C][C][=N][C][Branch2][Ring1][Ring1][C][S][=Branch1][C][=O][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2][=C][Ring2][Ring1][C][C]"
],
"smiles": [
"COCCCOc1ccnc(CSc2nc3ccccc3[nH]2)c1C",
"O=C(OO)c1cccc(Cl)c1",
"COCCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCOCC.ClCCl .",
"role": "assistant"
}
] | |
70,337
|
{
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][C][=C][Ring1][=Branch2][O][C][C][C][C][Br]",
"[F][C][=C][C][=C][C][Branch1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1][=N][NH1][C][Ring1][O][=C][Ring1][#C]",
"[C][O][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][C][=C][Ring1][=Branch2][O][C][C][C][C][N][C][C][C][Branch1][P][C][=N][NH1][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch2][Ring1][#Branch1][C][C][Ring1][S]"
],
"smiles": [
"COc1cc(C(C)=O)ccc1OCCCCBr",
"Fc1ccc2c(C3CCNCC3)n[nH]c2c1",
"COc1cc(C(C)=O)ccc1OCCCCN1CCC(c2n[nH]c3cc(F)ccc23)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: O .",
"role": "assistant"
}
] | |
70,338
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][N][C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][Ring2][Ring1][Ring2]",
"[O][=C][Branch1][C][O][C][N][C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][Ring2][Ring1][Ring2]"
],
"smiles": [
"CC(C)(C)OC(=O)Cn1c(SCc2ccccc2)nc2cc([N+](=O)[O-])ccc21",
"O=C(O)Cn1c(SCc2ccccc2)nc2cc([N+](=O)[O-])ccc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl.O=C(O)C(F)(F)F .",
"role": "assistant"
}
] | |
70,339
|
{
"selfies": [
"[C][C][=C][C][Branch2][Ring1][S][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][N][Branch1][=N][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][C][Ring1][=C][=N][O][Ring2][Ring1][=Branch1]",
"[C][C][=C][C][Branch2][Ring1][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][N][C][C][Ring1][Branch2][=N][O][Ring1][S]"
],
"smiles": [
"Cc1cc(-c2ccc3c(c2)CCN(C(=O)C(F)(F)F)CC3)no1",
"Cc1cc(-c2ccc3c(c2)CCNCC3)no1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
70,340
|
{
"selfies": [
"[C][C][C][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][#Branch2][N][C][Branch1][C][C][=O]",
"[C][C][C][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][#Branch2][N]"
],
"smiles": [
"CCCOc1cc2ccccc2cc1NC(C)=O",
"CCCOc1cc2ccccc2cc1N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,341
|
{
"selfies": [
"[C][S][Branch1][C][N][=Branch1][C][=O][=O]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][N][Branch2][Ring2][O][C][=C][C][=C][C][Branch2][Ring1][#C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][C][F][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2][N][Ring1][S][=C][Ring2][Ring1][=Branch1][C][C][Ring2][Ring1][N]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][N][Branch2][Branch1][Ring2][C][=C][C][=C][C][Branch2][Ring2][Branch2][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][C][F][=C][C][Branch1][=C][C][=Branch1][C][=O][N][S][Branch1][C][C][=Branch1][C][=O][=O][=C][Ring1][=C][N][Ring2][Ring1][Ring2][=C][Ring2][Ring1][#Branch2][C][C][Ring2][Ring1][S]"
],
"smiles": [
"CS(N)(=O)=O",
"Cc1ccccc1N1CCN(c2cccc(C3CC(C)(C)c4cc(F)cc(C(=O)O)c4N3)c2)CC1",
"Cc1ccccc1N1CCN(c2cccc(C3CC(C)(C)c4cc(F)cc(C(=O)NS(C)(=O)=O)c4N3)c2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl .",
"role": "assistant"
}
] | |
70,342
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][O][C][=C][C][Branch1][C][O][=C][C][Branch1][C][F][=C][Ring1][Branch2][Ring1][O]",
"[O][=C][Branch1][C][O][C][C][C][O][C][=C][C][Branch1][C][O][=C][C][Branch1][C][F][=C][Ring1][Branch2][Ring1][O]"
],
"smiles": [
"COC(=O)CC1COc2cc(O)cc(F)c21",
"O=C(O)CC1COc2cc(O)cc(F)c21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,343
|
{
"selfies": [
"[C][C][C][O][C][C][N][Ring1][=Branch1][C][=C][C][Branch1][S][C][Branch1][C][C][Branch1][C][C][S][Branch1][C][C][=Branch1][C][=O][=O][=N][C][Branch1][N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][=N][Ring2][Ring1][Ring2]",
"[O][=C][Branch1][C][Cl][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][C][O][C][C][N][Ring1][=Branch1][C][=C][C][Branch1][S][C][Branch1][C][C][Branch1][C][C][S][Branch1][C][C][=Branch1][C][=O][=O][=N][C][Branch2][Ring1][=Branch2][C][=C][C][=C][Branch1][#C][N][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][S][=N][Ring2][Ring1][=N]"
],
"smiles": [
"CC1COCCN1c1cc(C(C)(C)S(C)(=O)=O)nc(-c2ccc(N)cc2)n1",
"O=C(Cl)Oc1ccccc1",
"CC1COCCN1c1cc(C(C)(C)S(C)(=O)=O)nc(-c2ccc(NC(=O)Oc3ccccc3)cc2)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1COCCO1 .",
"role": "assistant"
}
] | |
70,344
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Branch1][C][Br][=C][Ring1][O]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][Br]"
],
"smiles": [
"COC(=O)c1ccc(C(=O)OC)c(Br)c1",
"COC(=O)c1ccc(C(=O)O)cc1Br"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
70,345
|
{
"selfies": [
"[C][O][C][=C][C][Branch1][C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][C][Br][C][Branch1][C][C][=C][Ring1][N]",
"[N][C][Branch1][C][N][=S]",
"[C][O][C][=C][C][Branch1][C][C][=C][Branch1][O][C][=C][S][C][Branch1][C][N][=N][Ring1][=Branch1][C][Branch1][C][C][=C][Ring1][=C]"
],
"smiles": [
"COc1cc(C)c(C(=O)CBr)c(C)c1",
"NC(N)=S",
"COc1cc(C)c(-c2csc(N)n2)c(C)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,346
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][C][Ring1][=C]",
"[O][=C][Branch1][C][O][C][C][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][C][Ring1][=C]"
],
"smiles": [
"CCOC(=O)C1CCc2nc(C(F)(F)F)ccc2C1",
"O=C(O)C1CCc2nc(C(F)(F)F)ccc2C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,347
|
{
"selfies": [
"[C][O][C][=C][C][Branch1][#C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Ring1][=C][N+1][=Branch1][C][=O][O-1]",
"[C][O][C][=C][C][Branch1][#C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Ring1][=C][N]"
],
"smiles": [
"COc1cc(CC(=O)OC(C)(C)C)ccc1[N+](=O)[O-]",
"COc1cc(CC(=O)OC(C)(C)C)ccc1N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCOC(C)=O.CO .",
"role": "assistant"
}
] | |
70,348
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Br]",
"[N][#C][C][Branch1][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][C][N][C][C][Ring1][=C]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][C][C][C][Branch1][Ring1][C][#N][Branch1][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][C][C][Ring1][S]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCCBr",
"N#CC1(c2ccc(Cl)cc2Cl)CCNCC1",
"CC(C)(C)OC(=O)NCCCN1CCC(C#N)(c2ccc(Cl)cc2Cl)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CC(C)=O .",
"role": "assistant"
}
] | |
70,349
|
{
"selfies": [
"[C][N][=C][=O]",
"[N][C][C][C][N][Branch1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][O][Ring1][Branch1][C][Ring1][=C]",
"[C][N][C][=Branch1][C][=O][N][C][C][C][N][Branch1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][O][Ring1][Branch1][C][Ring1][=C]"
],
"smiles": [
"CN=C=O",
"NC1CCN(c2cccc3c2CCO3)C1",
"CNC(=O)NC1CCN(c2cccc3c2CCO3)C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,350
|
{
"selfies": [
"[C][C][=Branch1][C][=O][Cl]",
"[O][=N+1][Branch1][C][O-1][C][C][=C][N][Branch1][Ring2][N][=Ring1][Branch1][C][C][N][C][Ring1][#Branch1]",
"[C][C][=Branch1][C][=O][N][C][C][N][N][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][Branch2][C][Ring1][N]"
],
"smiles": [
"CC(=O)Cl",
"O=[N+]([O-])c1cc2n(n1)CCNC2",
"CC(=O)N1CCn2nc([N+](=O)[O-])cc2C1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,351
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][Ring1][C][O][C][=C][Ring1][Branch2]"
],
"smiles": [
"COC(=O)c1ccccc1-c1ccc(C=O)cc1",
"COC(=O)c1ccccc1-c1ccc(CO)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,352
|
{
"selfies": [
"[O][=C][C][=C][N][Branch1][#Branch2][C][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][C][=C][N][Branch1][#Branch2][C][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][O][O]"
],
"smiles": [
"O=c1ccn(CC(F)(F)F)cc1OCc1ccccc1",
"O=c1ccn(CC(F)(F)F)cc1O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCO .",
"role": "assistant"
}
] | |
70,353
|
{
"selfies": [
"[C][C][C][N]",
"[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCCN",
"O=C(Cl)c1ccccc1",
"CCCNC(=O)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,354
|
{
"selfies": [
"[C][C][=C][C][=C][Branch2][Branch1][P][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring2][=N][C][=C][C][=C][Branch2][Ring1][P][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][Branch1][P][C][=C][C][=Branch1][C][=O][N][O][C][C][C][C][C][O][Ring1][=Branch1][=C][Ring1][P][C][=C][Ring2][Ring1][#Branch2][C][=C][Ring2][Ring1][S][C][=C][Ring2][Ring2][#Branch2]",
"[C][C][=C][C][=C][Branch2][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring2][Branch1][C][=C][C][=C][Branch2][Ring1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][Branch1][=Branch2][C][=C][C][=Branch1][C][=O][N][O][=C][Ring1][O][C][=C][Ring2][Ring1][Ring2][C][=C][Ring2][Ring1][#Branch2][C][=C][Ring2][Ring2][Ring2]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccc(S(=O)(=O)n4ccc(C=CC(=O)NOC5CCCCO5)c4)cc3)cc2)cc1",
"Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccc(S(=O)(=O)n4ccc(C=CC(=O)NO)c4)cc3)cc2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,355
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][S][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][C][Ring1][#C]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][S][C][Branch1][C][O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][C][Ring1][#C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(C(=O)c2ccc(Br)cc2)CC1",
"CC(C)(C)OC(=O)N1CCC(C(O)c2ccc(Br)cc2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,356
|
{
"selfies": [
"[Br][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][C][C][C][C][C][C][Cl]",
"[Cl][C][C][C][C][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"BrCc1ccccc1",
"OCCCCCCCl",
"ClCCCCCCOCc1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,357
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][Branch1][C][C][Ring1][P][C][C][Ring2][Ring1][Ring1]",
"[O][=C][Branch2][Ring1][#Branch1][N][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][Branch1][Branch1][C][C][Ring1][=Branch2][C][C][Ring1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"COC(=O)C12CCC(NC(=O)OCc3ccccc3)(CC1)CC2",
"O=C(NC12CCC(C(=O)O)(CC1)CC2)OCc1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,358
|
{
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][N][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"[N][C][=C][N][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"O=[N+]([O-])c1cnc(Cl)c(Cl)c1",
"Nc1cnc(Cl)c(Cl)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
70,359
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][Cl]",
"[C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][N]",
"[C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][N][C][=Branch1][C][=O][C][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)CC(=O)Cl",
"Cc1cc(Br)ccc1N",
"Cc1cc(Br)ccc1NC(=O)CC(C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
70,360
|
{
"selfies": [
"[C][C][=Branch1][C][=O][Cl]",
"[O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][N][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][C][Ring1][#Branch2][=C][Ring1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][=Branch1][C][=O][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][N][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][C][Ring1][#Branch2][=C][Ring1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(=O)Cl",
"OC(c1ccccc1)c1cnc2c(C(F)(F)F)cccc2c1-c1ccccc1",
"CC(=O)OC(c1ccccc1)c1cnc2c(C(F)(F)F)cccc2c1-c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,361
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][N][Branch2][Ring2][Ring1][C][=N][C][Branch2][Ring1][C][N][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][Ring1][O][C][=C][Ring1][#Branch2][=C][N][=C][S][C][Ring1][Branch1][=N][Ring2][Ring1][Ring2][C][Ring2][Ring1][=Branch2]",
"[C][O][C][=C][C][=C][Branch2][Ring1][#C][N][C][=N][C][Branch1][#C][N][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][Branch2][=N][C][S][C][=N][C][Ring1][P][=Ring1][Branch1][C][=C][Ring2][Ring1][Branch2][O][C]"
],
"smiles": [
"COC(=O)C1CCN(c2nc(Nc3ccc(OC)c(OC)c3)c3ncsc3n2)C1",
"COc1ccc(Nc2nc(N3CCC(C(=O)O)C3)nc3scnc23)cc1OC"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO.O .",
"role": "assistant"
}
] | |
70,362
|
{
"selfies": [
"[C][C][=C][C][=Branch2][Ring1][Branch1][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][C][C][=C][Ring1][#Branch2][N+1][=Branch1][C][=O][O-1][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][P]",
"[C][C][=C][Branch1][C][N][C][Branch1][C][C][=C][C][=Branch1][Branch1][=C][Ring1][Branch2][N][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][=Branch2]"
],
"smiles": [
"Cc1c2c(c([N+](=O)[O-])c(C)c1[N+](=O)[O-])C(C)(C)CC2",
"Cc1c(N)c(C)c2c(c1N)C(C)(C)CC2"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,363
|
{
"selfies": [
"[C][C][=Branch1][C][=O][O][C][Branch1][C][C][=O]",
"[C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Branch1][C][N][C][Branch1][C][O][C][C][O][C][Branch1][O][O][C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][N][Ring1][=N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Branch1][#Branch1][N][C][Branch1][C][C][=O][C][Branch1][C][O][C][C][O][C][Branch1][O][O][C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][N][Ring1][=N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(=O)OC(C)=O",
"CCc1ccccc1CC(N)C(O)C1COC(OCC(C)(C)C)C(C)N1C(=O)OC(C)(C)C",
"CCc1ccccc1CC(NC(C)=O)C(O)C1COC(OCC(C)(C)C)C(C)N1C(=O)OC(C)(C)C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl .",
"role": "assistant"
}
] | |
70,364
|
{
"selfies": [
"[C][S][C][=N][C][Branch1][C][Cl][=C][Branch1][Ring1][C][#N][C][Branch1][Branch1][N][C][C][O][=N][Ring1][=N]",
"[C][=C][C][=C][Branch1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring1][N]",
"[C][S][C][=N][C][Branch1][Branch1][N][C][C][O][=C][Branch1][Ring1][C][#N][C][Branch2][Ring1][Ring1][N][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][N][=N][Ring2][Ring1][Branch2]"
],
"smiles": [
"CSc1nc(Cl)c(C#N)c(NCCO)n1",
"c1ccc(C2CCNCC2)cc1",
"CSc1nc(NCCO)c(C#N)c(N2CCC(c3ccccc3)CC2)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl .",
"role": "assistant"
}
] | |
70,365
|
{
"selfies": [
"[C][C][C][Branch1][C][C][Branch1][C][C][C][C][C][C][Branch2][Branch1][O][O][C][=C][C][=C][C][=C][Branch2][Ring1][#C][C][Branch1][C][C][Branch1][O][C][O][P][=Branch1][C][=O][Branch1][C][O][O][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][C][Ring2][Ring1][=Branch1][=C][Ring2][Ring1][#Branch2][C][Branch1][C][F][Branch1][C][F][F][C][C][Ring2][Ring2][Branch1]",
"[C][C][C][Branch1][C][C][Branch1][C][C][C][C][C][C][Branch2][Ring2][=N][O][C][=C][C][=C][C][=C][Branch2][Ring1][C][C][Branch1][C][C][Branch1][C][N][C][O][P][=Branch1][C][=O][Branch1][C][O][O][C][=C][C][Ring1][#C][=C][Ring2][Ring1][Ring1][C][Branch1][C][F][Branch1][C][F][F][C][C][Ring2][Ring1][=C]"
],
"smiles": [
"CCC(C)(C)C1CCC(Oc2ccc3cc(C(C)(COP(=O)(O)O)NC(=O)OC(C)(C)C)ccc3c2C(F)(F)F)CC1",
"CCC(C)(C)C1CCC(Oc2ccc3cc(C(C)(N)COP(=O)(O)O)ccc3c2C(F)(F)F)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be Cl .",
"role": "assistant"
}
] | |
70,366
|
{
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][Branch2][C][C][O]",
"[O][C][C][C][=C][Branch1][Ring1][C][O][C][=C][C][Branch1][C][F][=C][Ring1][=Branch2][F]"
],
"smiles": [
"O=C(O)c1ccc(F)c(F)c1CCO",
"OCCc1c(CO)ccc(F)c1F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1CCOC1 .",
"role": "assistant"
}
] | |
70,367
|
{
"selfies": [
"[C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][Branch1][=C][C][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][C][Branch1][#C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][N][Ring2][Ring1][Branch2][C][C][C][C][C][C][Ring1][=Branch1]",
"[C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][Branch1][=C][C][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][C][Branch1][C][N][C][N][Ring1][P][C][C][C][C][C][C][Ring1][=Branch1]"
],
"smiles": [
"Cc1ccc2c(c1)N(CC(=O)C(C)(C)C)C(=O)C(NC(=O)OC(C)(C)C)CN2C1CCCCC1",
"Cc1ccc2c(c1)N(CC(=O)C(C)(C)C)C(=O)C(N)CN2C1CCCCC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCO .",
"role": "assistant"
}
] | |
70,368
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][=Branch1][C][C][O][C][=C][C][=C][Branch1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring1][N][C][C][Ring2][Ring1][Branch1]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=N][N][=C][C][=C][C][Branch1][C][Cl][=N][N][Ring1][#Branch2][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Branch1][Ring1][C][C][O][C][=C][C][=C][Branch2][Ring2][Ring2][C][C][C][N][Branch2][Ring1][Branch2][C][C][=C][C][=N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][N][Ring1][=Branch2][N][=Ring1][=N][C][C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][=Branch2][C][C][Ring2][Ring2][C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(CCOc2ccc(C3CCNCC3)cc2)CC1",
"FC(F)(F)c1nnc2ccc(Cl)nn12",
"CC(C)(C)OC(=O)N1CCN(CCOc2ccc(C3CCN(c4ccc5nnc(C(F)(F)F)n5n4)CC3)cc2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CN(C)C=O .",
"role": "assistant"
}
] | |
70,369
|
{
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][P]",
"[C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=N]"
],
"smiles": [
"COc1ccc(CC(C(=O)O)c2ccccc2)cc1",
"COc1ccc2c(c1)C(=O)C(c1ccccc1)C2"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,370
|
{
"selfies": [
"[C][C][=C][C][=C][Branch2][Ring1][#Branch1][C][C][N][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][=C][Ring2][Ring1][Ring2]",
"[O][=C][Branch1][C][O][C][=C][Branch1][C][F][C][Branch1][C][F][=C][C][C][=C][NH1][C][Ring1][O][=Ring1][Branch1]",
"[C][C][=C][C][=C][Branch2][Ring2][P][C][C][N][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][=Branch1][C][=O][C][=C][Branch1][C][F][C][Branch1][C][F][=C][C][C][=C][NH1][C][Ring1][O][=Ring1][Branch1][C][=C][Ring2][Ring1][P]"
],
"smiles": [
"Cc1ccc(CCNCc2ccc(C(C)(C)C)cc2)cc1",
"O=C(O)c1c(F)c(F)cc2cc[nH]c12",
"Cc1ccc(CCN(Cc2ccc(C(C)(C)C)cc2)C(=O)c2c(F)c(F)cc3cc[nH]c23)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,371
|
{
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[O][=S][=Branch1][C][=O][C][C][C][Branch1][C][O][C][C][Ring1][Branch2]",
"[C][C][=C][C][=C][Branch2][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][C][Ring1][Branch2][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)Cl)cc1",
"O=S1(=O)CCC(O)CC1",
"Cc1ccc(S(=O)(=O)OC2CCS(=O)(=O)CC2)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be c1ccncc1 .",
"role": "assistant"
}
] | |
70,372
|
{
"selfies": [
"[C][C][C][C][N][=C][=O]",
"[C][C][C][C][C][=N][C][=C][Branch1][C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][O][N][Ring1][=C][C][C][C][N]",
"[C][C][C][C][N][C][=Branch1][C][=O][N][C][C][C][N][C][Branch1][Branch1][C][C][C][C][=N][C][=C][Branch1][C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][O][Ring2][Ring1][C]"
],
"smiles": [
"CCCCN=C=O",
"CCCCc1nc2c(N)nc3ccccc3c2n1CCCN",
"CCCCNC(=O)NCCCn1c(CCCC)nc2c(N)nc3ccccc3c21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CN1CCCC1=O.O .",
"role": "assistant"
}
] | |
70,373
|
{
"selfies": [
"[O][=C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#C]",
"[N][C][=C][C][=C][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#C][C][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"O=C(c1ccc([N+](=O)[O-])cc1)N1CCc2ccccc2-c2ccccc21",
"Nc1ccc(C(=O)N2CCc3ccccc3-c3ccccc32)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO.CCOC(C)=O .",
"role": "assistant"
}
] | |
70,374
|
{
"selfies": [
"[C][N][Branch2][Ring1][C][C][=N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][S][Ring1][=Branch2][C][C][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][S]",
"[C][N][Branch2][Ring1][C][C][=N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][S][Ring1][=Branch2][C][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"CN(c1nnc(C(F)(F)F)s1)C1CCN(C(=O)OCc2ccccc2)CC1",
"CN(c1nnc(C(F)(F)F)s1)C1CCNCC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be O .",
"role": "assistant"
}
] | |
70,375
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[N][C][C][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"NCCc1ccc(O)cc1",
"CC(C)(C)OC(=O)NCCc1ccc(O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1.O .",
"role": "assistant"
}
] | |
70,376
|
{
"selfies": [
"[C][=C][C][Br]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][=C][C][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]"
],
"smiles": [
"C=CCBr",
"O=[N+]([O-])c1ccc(O)cc1",
"C=CCOc1ccc([N+](=O)[O-])cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be Cc1ccccc1 .",
"role": "assistant"
}
] | |
70,377
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Branch2][Ring1][=Branch2][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][N+1][=Branch1][C][=O][O-1][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2]",
"[C][O][C][=Branch1][C][=O][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Branch2][Ring1][Branch1][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][N][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2]"
],
"smiles": [
"COC(=O)C(C(=O)OC)C(Cc1cc(C(F)(F)F)ccc1[N+](=O)[O-])c1ccc(OC)cc1",
"COC(=O)C(C(=O)OC)C(Cc1cc(C(F)(F)F)ccc1N)c1ccc(OC)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
70,378
|
{
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][=C][C][=C][C][=C][Ring1][=C][Ring1][=Branch1]",
"[N][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][=C][C][=C][C][=C][Ring1][=C][Ring1][=Branch1]"
],
"smiles": [
"O=[N+]([O-])c1c2ccccc2cc2ccccc12",
"Nc1c2ccccc2cc2ccccc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)O.Cl .",
"role": "assistant"
}
] | |
70,379
|
{
"selfies": [
"[N][C][=C][C][=C][Branch1][C][F][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#Branch2]",
"[O][=C][Branch1][=N][N][C][=C][C][=C][C][Branch1][C][O][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]",
"[N][C][=C][C][=C][Branch2][Ring1][=Branch2][O][C][=C][C][=C][C][Branch1][=C][N][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=N][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"Nc1ccc(F)c([N+](=O)[O-])c1",
"O=C(Nc1cccc(O)c1)C(F)(F)F",
"Nc1ccc(Oc2cccc(NC(=O)C(F)(F)F)c2)c([N+](=O)[O-])c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,380
|
{
"selfies": [
"[C][O][C][=C][C][Branch2][Ring1][#Branch1][C][C][=N][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=Ring1][N][=C][Branch1][C][F][C][=C][Ring2][Ring1][Ring1][O]",
"[O][=S][=Branch1][C][=O][Branch2][Ring1][O][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[C][O][C][=C][C][Branch2][Ring1][#Branch1][C][C][=N][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=Ring1][N][=C][Branch1][C][F][C][=C][Ring2][Ring1][Ring1][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"COc1cc(-c2cnn(C(=O)OC(C)(C)C)c2)c(F)cc1O",
"O=S(=O)(N(c1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F",
"COc1cc(-c2cnn(C(=O)OC(C)(C)C)c2)c(F)cc1OS(=O)(=O)C(F)(F)F"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,381
|
{
"selfies": [
"[C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][N][C][C][Ring1][=Branch1]",
"[C][C][=C][C][Branch1][C][Cl][=N][C][Branch1][C][C][=N][Ring1][Branch2]",
"[C][C][=C][C][Branch2][Ring1][#C][N][C][C][C][Branch2][Ring1][Ring1][N][Branch1][C][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring2][Ring1][C][=N][C][Branch1][C][C][=N][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CN(C(=O)OCc1ccccc1)C1CCNCC1",
"Cc1cc(Cl)nc(C)n1",
"Cc1cc(N2CCC(N(C)C(=O)OCc3ccccc3)CC2)nc(C)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CC(C)=O .",
"role": "assistant"
}
] | |
70,382
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[Cl][C][=N][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch1][N][C][=N][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1][C][C][Ring1][=N]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCNCC1",
"Clc1ncc(Br)cn1",
"CC(C)(C)OC(=O)N1CCN(c2ncc(Br)cn2)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC#N .",
"role": "assistant"
}
] | |
70,383
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][C][=C][Branch1][Ring1][C][N][C][=C][Ring1][Branch2]",
"[N][C][C][=C][C][=C][Branch1][#C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][S]"
],
"smiles": [
"COC(=O)c1ccccc1Cc1ccc(CN)cc1",
"NCc1ccc(Cc2ccccc2C(=O)O)cc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,384
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=N][N][Branch1][Branch2][C][C][C][C][C][Ring1][Branch1][C][Ring1][#Branch2][=C][Ring1][=C]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=N][N][Branch1][Branch2][C][C][C][C][C][Ring1][Branch1][C][Ring1][#Branch2][=C][Ring1][=C]"
],
"smiles": [
"COC(=O)c1ccc2cnn(C3CCCC3)c2c1",
"O=C(O)c1ccc2cnn(C3CCCC3)c2c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,385
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=C][S][C][=C][N][=C][N][Ring1][Branch2][Ring1][Branch1]",
"[O][C][C][C][=C][S][C][=C][N][=C][N][Ring1][Branch2][Ring1][Branch1]"
],
"smiles": [
"CCOC(=O)Cc1csc2cncn12",
"OCCc1csc2cncn12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
70,386
|
{
"selfies": [
"[Br][Br]",
"[C][=C][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][=C][C][=C][C][=C][Ring1][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring2]",
"[Br][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring2][Ring1][Ring2][Ring1][=Branch1]"
],
"smiles": [
"BrBr",
"c1ccc(-c2c3ccccc3cc3ccccc23)cc1",
"Brc1c2ccccc2c(-c2ccccc2)c2ccccc12"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
70,387
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][=Branch2][C][=C][C][=C][O][Ring1][Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][N][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][=Branch2][C][=C][C][=C][O][Ring1][Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"NCc1ccccc1-n1nc(C(F)(F)F)cc1-c1ccco1",
"CC(C)(C)OC(=O)NCc1ccccc1-n1nc(C(F)(F)F)cc1-c1ccco1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1CCOC1.CCOC(C)=O .",
"role": "assistant"
}
] | |
70,388
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][N][=C][Branch1][C][Cl][C][Branch1][C][C][=N][Ring1][Branch2]",
"[O][C][C][Branch1][C][F][Branch1][C][F][F]",
"[C][O][C][=Branch1][C][=O][C][=C][N][=C][Branch1][O][O][C][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][C][=N][Ring1][=N]"
],
"smiles": [
"COC(=O)c1cnc(Cl)c(C)n1",
"OCC(F)(F)F",
"COC(=O)c1cnc(OCC(F)(F)F)c(C)n1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,389
|
{
"selfies": [
"[C][C][=Branch2][=Branch1][Ring2][=C][C][Branch1][=Branch1][C][Branch1][C][C][C][N][Branch1][C][C][C][=Branch1][C][=O][C][Branch2][Ring2][#Branch1][N][C][C][Branch2][Ring1][C][N][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][Branch1][C][C][C][C][=Branch1][C][=O][O]",
"[C][N][C][Branch2][Ring2][=Branch2][C][N][C][Branch2][Ring1][O][C][=Branch1][C][=O][N][Branch1][C][C][C][Branch1][O][C][=C][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(=CC(C(C)C)N(C)C(=O)C(NCC(N(C)C(=O)OC(C)(C)C)C(C)(C)c1ccccc1)C(C)(C)C)C(=O)O",
"CNC(CNC(C(=O)N(C)C(C=C(C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,390
|
{
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[O][C][=C][C][=C][NH1][N][=C][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][=C][C][=C][NH1][N][=C][C][Ring1][Branch1][=C][Ring1][=Branch2]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)Cl",
"Oc1ccc2[nH]ncc2c1",
"CC(C)(C)[Si](C)(C)Oc1ccc2[nH]ncc2c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
70,391
|
{
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][N][C][=Branch1][C][=O][C][C][Branch1][C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][S][C][=Ring1][=N][N][Branch1][C][C][C][Ring2][Ring1][Ring1][=O]",
"[C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][S][C][=C][Ring1][N][C][=Branch1][C][=O][N][Branch1][Branch1][C][C][C][O][C][=Branch1][C][=O][N][Ring1][N][C]"
],
"smiles": [
"COC(=O)CCn1c(=O)c2c(C)c(-c3ccc(Cl)cc3)sc2n(C)c1=O",
"Cc1c(-c2ccc(Cl)cc2)sc2c1c(=O)n(CCCO)c(=O)n2C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
70,392
|
{
"selfies": [
"[C][C][=C][C][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][=C][Ring1][#Branch2]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][C][Branch1][Ring1][C][Br][=C][Ring1][Branch2]"
],
"smiles": [
"Cc1cccc(S(=O)(=O)Cl)c1",
"O=C1CCC(=O)N1Br",
"O=S(=O)(Cl)c1cccc(CBr)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CC#N .",
"role": "assistant"
}
] | |
70,393
|
{
"selfies": [
"[C][C][=C][C][=C][Branch1][N][N][C][=Branch1][C][=O][C][N][Branch1][C][C][C][C][=C][Ring1][=N][N+1][=Branch1][C][=O][O-1]",
"[C][C][=C][C][=C][Branch1][N][N][C][=Branch1][C][=O][C][N][Branch1][C][C][C][C][=C][Ring1][=N][N]"
],
"smiles": [
"Cc1ccc(NC(=O)CN(C)C)cc1[N+](=O)[O-]",
"Cc1ccc(NC(=O)CN(C)C)cc1N"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
70,394
|
{
"selfies": [
"[C][C][=Branch1][C][=O][O][C][Branch1][C][C][=O]",
"[C][C][C][C][=C][Branch2][Ring1][#Branch2][O][C][C][C][S][C][=N][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][NH1][Ring1][N][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][#Branch2][O]",
"[C][C][C][C][=C][Branch2][Ring1][#Branch2][O][C][C][C][S][C][=N][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][NH1][Ring1][N][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][#Branch2][O][C][Branch1][C][C][=O]"
],
"smiles": [
"CC(=O)OC(C)=O",
"CCCc1c(OCCCSc2nc3ccc(C(=O)O)cc3[nH]2)ccc(C(C)=O)c1O",
"CCCc1c(OCCCSc2nc3ccc(C(=O)O)cc3[nH]2)ccc(C(C)=O)c1OC(C)=O"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
70,395
|
{
"selfies": [
"[C][C][=Branch1][C][=O][O][C][Branch1][C][C][=O]",
"[C][C][=C][Branch1][C][N][C][=C][C][=C][Ring1][#Branch1][F]",
"[C][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C]"
],
"smiles": [
"CC(=O)OC(C)=O",
"Cc1c(N)cccc1F",
"CC(=O)Nc1cccc(F)c1C"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "Cc1ccccc1 .",
"role": "assistant"
}
] | |
70,396
|
{
"selfies": [
"[O][=C][C][C][C][=C][C][=C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][=C][Ring1][=N][Ring1][S]",
"[O][C][C][C][C][=C][C][=C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][=C][Ring1][=N][Ring1][S]"
],
"smiles": [
"O=C1CCc2ccc(-c3cccc(F)c3)cc21",
"OC1CCc2ccc(-c3cccc(F)c3)cc21"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO .",
"role": "assistant"
}
] | |
70,397
|
{
"selfies": [
"[C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][C][C][Ring1][#Branch1]",
"[C][C][=C][Branch1][C][Cl][N][=C][N][=C][Ring1][#Branch1][Cl]",
"[C][C][=C][Branch1][C][Cl][N][=C][N][=C][Ring1][#Branch1][O][C][C][C][N][Branch1][O][C][=Branch1][C][=O][O][C][Branch1][C][C][C][C][C][Ring1][N]"
],
"smiles": [
"CC(C)OC(=O)N1CCC(O)CC1",
"Cc1c(Cl)ncnc1Cl",
"Cc1c(Cl)ncnc1OC1CCN(C(=O)OC(C)C)CC1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
70,398
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][Branch2][O][Ring1][O]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch1][O][Ring1][#Branch2]"
],
"smiles": [
"CCOC(=O)c1cc2cc(OC)ccc2o1",
"CCOC(=O)c1cc2cc(O)ccc2o1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be ClCCl .",
"role": "assistant"
}
] | |
70,399
|
{
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=N][N][Branch2][Ring1][N][C][=N][C][=C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Branch1][C][Cl][C][=C][Ring1][=C][NH1][Ring1][P][C][=Ring2][Ring1][=Branch1]",
"[O][=C][Branch1][C][O][C][C][=N][N][Branch2][Ring1][N][C][=N][C][=C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Branch1][C][Cl][C][=C][Ring1][=C][NH1][Ring1][P][C][=Ring2][Ring1][=Branch1]"
],
"smiles": [
"CCOC(=O)c1cnn(-c2nc3cc(Oc4ccccc4)c(Cl)cc3[nH]2)c1",
"O=C(O)c1cnn(-c2nc3cc(Oc4ccccc4)c(Cl)cc3[nH]2)c1"
]
}
|
[
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CC(=O)O .",
"role": "assistant"
}
] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.